C17H24N2O3S — CID 44601995
(3S)-2-benzyl-1,1-dioxo-3-propan-2-yl-5-prop-2-enyl-1,2,5-thiadiazepan-4-one (PubChem CID 44601995) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is (3S)-2-benzyl-1,1-dioxo-3-propan-2-yl-5-prop-2-enyl-1,2,5-thiadiazepan-4-one.
| Compound Name | (3S)-2-benzyl-1,1-dioxo-3-propan-2-yl-5-prop-2-enyl-1,2,5-thiadiazepan-4-one |
|---|---|
| PubChem CID | 44601995 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (3S)-2-benzyl-1,1-dioxo-3-propan-2-yl-5-prop-2-enyl-1,2,5-thiadiazepan-4-one |
| SMILES | C=CCN1CCS(=O)(=O)N(Cc2ccccc2)[C@@H](C(C)C)C1=O |
| InChI | InChI=1S/C17H24N2O3S/c1-4-10-18-11-12-23(21,22)19(16(14(2)3)17(18)20)13-15-8-6-5-7-9-15/h4-9,14,16H,1,10-13H2,2-3H3/t16-/m0/s1 |
| InChIKey | OVSNZFSNUCAOPY-INIZCTEOSA-N |
| XLogP | 1.87 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|