C24H33NO4S — CID 44602018
(6S)-5-[[2-(2-butoxyphenyl)phenyl]methyl]-6-propan-2-yl-1,4,5-oxathiazepane 4,4-dioxide (PubChem CID 44602018) has the molecular formula C24H33NO4S and a molecular weight of 431.60 g/mol. Its IUPAC name is (6S)-5-[[2-(2-butoxyphenyl)phenyl]methyl]-6-propan-2-yl-1,4,5-oxathiazepane 4,4-dioxide.
| Compound Name | (6S)-5-[[2-(2-butoxyphenyl)phenyl]methyl]-6-propan-2-yl-1,4,5-oxathiazepane 4,4-dioxide |
|---|---|
| PubChem CID | 44602018 |
| Molecular Formula | C24H33NO4S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (6S)-5-[[2-(2-butoxyphenyl)phenyl]methyl]-6-propan-2-yl-1,4,5-oxathiazepane 4,4-dioxide |
| SMILES | CCCCOc1ccccc1-c1ccccc1CN1[C@@H](C(C)C)COCCS1(=O)=O |
| InChI | InChI=1S/C24H33NO4S/c1-4-5-14-29-24-13-9-8-12-22(24)21-11-7-6-10-20(21)17-25-23(19(2)3)18-28-15-16-30(25,26)27/h6-13,19,23H,4-5,14-18H2,1-3H3/t23-/m1/s1 |
| InChIKey | LHBHKCLDBVMELX-HSZRJFAPSA-N |
| XLogP | 4.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|