C38H48N4O4 — CID 44602077
(1S,3R,12bS)-3-[2-(1-adamantylmethylamino)-2-oxoethyl]-N,N-diethyl-10-(furan-2-yl)-12b-methyl-4-oxo-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizine-1-carboxamide (PubChem CID 44602077) has the molecular formula C38H48N4O4 and a molecular weight of 624.83 g/mol. Its IUPAC name is (1S,3R,12bS)-3-[2-(1-adamantylmethylamino)-2-oxoethyl]-N,N-diethyl-10-(furan-2-yl)-12b-methyl-4-oxo-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizine-1-carboxamide.
| Compound Name | (1S,3R,12bS)-3-[2-(1-adamantylmethylamino)-2-oxoethyl]-N,N-diethyl-10-(furan-2-yl)-12b-methyl-4-oxo-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizine-1-carboxamide |
|---|---|
| PubChem CID | 44602077 |
| Molecular Formula | C38H48N4O4 |
| Molecular Weight | 624.83 g/mol |
| Exact Mass | 624.37 |
| IUPAC Name | (1S,3R,12bS)-3-[2-(1-adamantylmethylamino)-2-oxoethyl]-N,N-diethyl-10-(furan-2-yl)-12b-methyl-4-oxo-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizine-1-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1C[C@H](CC(=O)NCC23CC4CC(CC(C4)C2)C3)C(=O)N2CCc3c([nH]c4cc(-c5ccco5)ccc34)[C@]12C |
| InChI | InChI=1S/C38H48N4O4/c1-4-41(5-2)36(45)30-16-27(18-33(43)39-22-38-19-23-13-24(20-38)15-25(14-23)21-38)35(44)42-11-10-29-28-9-8-26(32-7-6-12-46-32)17-31(28)40-34(29)37(30,42)3/h6-9,12,17,23-25,27,30,40H,4-5,10-11,13-16,18-22H2,1-3H3,(H,39,43)/t23?,24?,25?,27-,30-,37+,38?/m1/s1 |
| InChIKey | OUUMGDIPZNABPJ-SZOWAOAISA-N |
| XLogP | 6.26 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.83 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |