About 4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate
4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate (PubChem CID 44602396) has the molecular formula C30H33NO4
and a molecular weight of 471.60 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate.
Molecular Properties
| Compound Name | 4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate |
| PubChem CID | 44602396 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate |
| SMILES | COC(=O)C(C)(C)[C@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H33NO4/c1-28(2,3)35-26(32)25(29(4,5)27(33)34-6)31-30(20-14-8-7-9-15-20)23-18-12-10-16-21(23)22-17-11-13-19-24(22)30/h7-19,25,31H,1-6H3/t25-/m1/s1 |
| InChIKey | LLZBBEXATPFSPA-RUZDIDTESA-N |
| XLogP | 5.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate?
The IUPAC name of 4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate (CID 44602396) is 4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate.
What is the SMILES notation for 4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate?
The canonical SMILES for 4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate is COC(=O)C(C)(C)[C@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C.
What is the InChIKey of 4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate?
The InChIKey is LLZBBEXATPFSPA-RUZDIDTESA-N. The full InChI is InChI=1S/C30H33NO4/c1-28(2,3)35-26(32)25(29(4,5)27(33)34-6)31-30(20-14-8-7-9-15-20)23-18-12-10-16-21(23)22-17-11-13-19-24(22)30/h7-19,25,31H,1-6H3/t25-/m1/s1.
What are the key properties of 4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate?
4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate has a molecular weight of 471.60 g/mol, XLogP of 5.46, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 1-O-methyl (3S)-2,2-dimethyl-3-[(9-phenylfluoren-9-yl)amino]butanedioate is sourced from PubChem (CID 44602396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).