About tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate
tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate (PubChem CID 44602403) has the molecular formula C29H33NO3
and a molecular weight of 443.59 g/mol. Its IUPAC name is tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate.
Molecular Properties
| Compound Name | tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate |
| PubChem CID | 44602403 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(C)(C)CO |
| InChI | InChI=1S/C29H33NO3/c1-27(2,3)33-26(32)25(28(4,5)19-31)30-29(20-13-7-6-8-14-20)23-17-11-9-15-21(23)22-16-10-12-18-24(22)29/h6-18,25,30-31H,19H2,1-5H3/t25-/m1/s1 |
| InChIKey | LMWHEZIUHUPFIQ-RUZDIDTESA-N |
| XLogP | 5.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate?
The IUPAC name of tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate (CID 44602403) is tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate.
What is the SMILES notation for tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate?
The canonical SMILES for tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate is CC(C)(C)OC(=O)[C@@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(C)(C)CO.
What is the InChIKey of tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate?
The InChIKey is LMWHEZIUHUPFIQ-RUZDIDTESA-N. The full InChI is InChI=1S/C29H33NO3/c1-27(2,3)33-26(32)25(28(4,5)19-31)30-29(20-13-7-6-8-14-20)23-17-11-9-15-21(23)22-16-10-12-18-24(22)29/h6-18,25,30-31H,19H2,1-5H3/t25-/m1/s1.
What are the key properties of tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate?
tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate has a molecular weight of 443.59 g/mol, XLogP of 5.28, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-4-hydroxy-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]butanoate is sourced from PubChem (CID 44602403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).