C22H16F3N5O2 — CID 44602985
N-methyl-4-[2-[4-(trifluoromethyl)anilino]quinazolin-6-yl]oxypyridine-2-carboxamide (PubChem CID 44602985) has the molecular formula C22H16F3N5O2 and a molecular weight of 439.40 g/mol. Its IUPAC name is N-methyl-4-[2-[4-(trifluoromethyl)anilino]quinazolin-6-yl]oxypyridine-2-carboxamide.
| Compound Name | N-methyl-4-[2-[4-(trifluoromethyl)anilino]quinazolin-6-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 44602985 |
| Molecular Formula | C22H16F3N5O2 |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-methyl-4-[2-[4-(trifluoromethyl)anilino]quinazolin-6-yl]oxypyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc3nc(Nc4ccc(C(F)(F)F)cc4)ncc3c2)ccn1 |
| InChI | InChI=1S/C22H16F3N5O2/c1-26-20(31)19-11-17(8-9-27-19)32-16-6-7-18-13(10-16)12-28-21(30-18)29-15-4-2-14(3-5-15)22(23,24)25/h2-12H,1H3,(H,26,31)(H,28,29,30) |
| InChIKey | TVMDXCWYKITPSK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |