C24H25F2N3O5S — CID 44603061
N-[2-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-2-[(5-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-1,3-oxazole-4-carboxamide (PubChem CID 44603061) has the molecular formula C24H25F2N3O5S and a molecular weight of 505.54 g/mol. Its IUPAC name is N-[2-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-2-[(5-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[2-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-2-[(5-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 44603061 |
| Molecular Formula | C24H25F2N3O5S |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N-[2-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-2-[(5-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-1,3-oxazole-4-carboxamide |
| SMILES | CC1CCCc2c(Oc3nc(C(=O)NCCc4cc(F)c(NS(C)(=O)=O)c(F)c4)co3)cccc21 |
| InChI | InChI=1S/C24H25F2N3O5S/c1-14-5-3-7-17-16(14)6-4-8-21(17)34-24-28-20(13-33-24)23(30)27-10-9-15-11-18(25)22(19(26)12-15)29-35(2,31)32/h4,6,8,11-14,29H,3,5,7,9-10H2,1-2H3,(H,27,30) |
| InChIKey | FEPZQRVRHIWTOF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |