About 2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione
2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione (PubChem CID 44603286) has the molecular formula C17H12N2O2
and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione.
Molecular Properties
| Compound Name | 2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
| PubChem CID | 44603286 |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
| SMILES | CCc1nc2c3c(ccc2[nH]1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C17H12N2O2/c1-2-13-18-12-8-7-11-14(15(12)19-13)17(21)10-6-4-3-5-9(10)16(11)20/h3-8H,2H2,1H3,(H,18,19) |
| InChIKey | ADOUNJBEKVZHQH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione?
The IUPAC name of 2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione (CID 44603286) is 2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione.
What is the SMILES notation for 2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione?
The canonical SMILES for 2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione is CCc1nc2c3c(ccc2[nH]1)C(=O)c1ccccc1C3=O.
What is the InChIKey of 2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione?
The InChIKey is ADOUNJBEKVZHQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O2/c1-2-13-18-12-8-7-11-14(15(12)19-13)17(21)10-6-4-3-5-9(10)16(11)20/h3-8H,2H2,1H3,(H,18,19).
What are the key properties of 2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione?
2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione has a molecular weight of 276.29 g/mol, XLogP of 2.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione is sourced from PubChem (CID 44603286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).