C10H14O3 — CID 44603744
(3R,3aS,6S,6aR)-3,6-dimethyl-1-oxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-3-carbaldehyde (PubChem CID 44603744) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (3R,3aS,6S,6aR)-3,6-dimethyl-1-oxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-3-carbaldehyde.
| Compound Name | (3R,3aS,6S,6aR)-3,6-dimethyl-1-oxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-3-carbaldehyde |
|---|---|
| PubChem CID | 44603744 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (3R,3aS,6S,6aR)-3,6-dimethyl-1-oxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-3-carbaldehyde |
| SMILES | C[C@H]1CC[C@H]2[C@@H]1C(=O)O[C@@]2(C)C=O |
| InChI | InChI=1S/C10H14O3/c1-6-3-4-7-8(6)9(12)13-10(7,2)5-11/h5-8H,3-4H2,1-2H3/t6-,7-,8+,10-/m0/s1 |
| InChIKey | YGEBHWBUFAIGMM-OORONAJNSA-N |
| XLogP | 1.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|