C13H14N2O — CID 44603809
N,N-bis(prop-2-enyl)-1,3-benzoxazol-2-amine (PubChem CID 44603809) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-1,3-benzoxazol-2-amine.
| Compound Name | N,N-bis(prop-2-enyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 44603809 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N,N-bis(prop-2-enyl)-1,3-benzoxazol-2-amine |
| SMILES | C=CCN(CC=C)c1nc2ccccc2o1 |
| InChI | InChI=1S/C13H14N2O/c1-3-9-15(10-4-2)13-14-11-7-5-6-8-12(11)16-13/h3-8H,1-2,9-10H2 |
| InChIKey | GKJDXKLDZSUFIN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|