C25H28F3NO2 — CID 44603970
ethyl 2-methyl-3-methylidene-2-[C-methyl-N-[4-(trifluoromethyl)phenyl]carbonimidoyl]-6-phenylhexanoate (PubChem CID 44603970) has the molecular formula C25H28F3NO2 and a molecular weight of 431.50 g/mol. Its IUPAC name is ethyl 2-methyl-3-methylidene-2-[C-methyl-N-[4-(trifluoromethyl)phenyl]carbonimidoyl]-6-phenylhexanoate.
| Compound Name | ethyl 2-methyl-3-methylidene-2-[C-methyl-N-[4-(trifluoromethyl)phenyl]carbonimidoyl]-6-phenylhexanoate |
|---|---|
| PubChem CID | 44603970 |
| Molecular Formula | C25H28F3NO2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | ethyl 2-methyl-3-methylidene-2-[C-methyl-N-[4-(trifluoromethyl)phenyl]carbonimidoyl]-6-phenylhexanoate |
| SMILES | C=C(CCCc1ccccc1)C(C)(C(=O)OCC)/C(C)=N/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H28F3NO2/c1-5-31-23(30)24(4,18(2)10-9-13-20-11-7-6-8-12-20)19(3)29-22-16-14-21(15-17-22)25(26,27)28/h6-8,11-12,14-17H,2,5,9-10,13H2,1,3-4H3/b29-19+ |
| InChIKey | XWGCTQIJHCGPOW-VUTHCHCSSA-N |
| XLogP | 6.95 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|