C20H39N — CID 44604050
(2E,6E)-N,N-diethyl-9,9,11,11-tetramethyldodeca-2,6-dien-1-amine (PubChem CID 44604050) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is (2E,6E)-N,N-diethyl-9,9,11,11-tetramethyldodeca-2,6-dien-1-amine.
| Compound Name | (2E,6E)-N,N-diethyl-9,9,11,11-tetramethyldodeca-2,6-dien-1-amine |
|---|---|
| PubChem CID | 44604050 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | (2E,6E)-N,N-diethyl-9,9,11,11-tetramethyldodeca-2,6-dien-1-amine |
| SMILES | CCN(CC)C/C=C/CC/C=C/CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C20H39N/c1-8-21(9-2)17-15-13-11-10-12-14-16-20(6,7)18-19(3,4)5/h12-15H,8-11,16-18H2,1-7H3/b14-12+,15-13+ |
| InChIKey | FTSMYZWOICSUBA-QUMQEAAQSA-N |
| XLogP | 6.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|