C9H15NO4 — CID 44604239
(4S)-4-(oxan-2-yloxymethyl)-1,3-oxazolidin-2-one (PubChem CID 44604239) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is (4S)-4-(oxan-2-yloxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-(oxan-2-yloxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 44604239 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | (4S)-4-(oxan-2-yloxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@@H](COC2CCCCO2)CO1 |
| InChI | InChI=1S/C9H15NO4/c11-9-10-7(6-14-9)5-13-8-3-1-2-4-12-8/h7-8H,1-6H2,(H,10,11)/t7-,8?/m0/s1 |
| InChIKey | LTYVFQOKSNVPSR-JAMMHHFISA-N |
| XLogP | 0.64 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |