C15H31IOSi — CID 44604241
[(E,2R)-5-iodo-2-methylpent-4-enoxy]-tri(propan-2-yl)silane (PubChem CID 44604241) has the molecular formula C15H31IOSi and a molecular weight of 382.40 g/mol. Its IUPAC name is [(E,2R)-5-iodo-2-methylpent-4-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(E,2R)-5-iodo-2-methylpent-4-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 44604241 |
| Molecular Formula | C15H31IOSi |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [(E,2R)-5-iodo-2-methylpent-4-enoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC[C@H](C)C/C=C/I)(C(C)C)C(C)C |
| InChI | InChI=1S/C15H31IOSi/c1-12(2)18(13(3)4,14(5)6)17-11-15(7)9-8-10-16/h8,10,12-15H,9,11H2,1-7H3/b10-8+/t15-/m1/s1 |
| InChIKey | CCRYWBWGSQJFST-TUPIDYKKSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|