C26H31NO12S — CID 44604366
methyl (3aR,4R,6S,7aS)-3-acetyl-6-(4-methylphenyl)sulfanyl-2-oxo-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate (PubChem CID 44604366) has the molecular formula C26H31NO12S and a molecular weight of 581.60 g/mol. Its IUPAC name is methyl (3aR,4R,6S,7aS)-3-acetyl-6-(4-methylphenyl)sulfanyl-2-oxo-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate.
| Compound Name | methyl (3aR,4R,6S,7aS)-3-acetyl-6-(4-methylphenyl)sulfanyl-2-oxo-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 44604366 |
| Molecular Formula | C26H31NO12S |
| Molecular Weight | 581.60 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | methyl (3aR,4R,6S,7aS)-3-acetyl-6-(4-methylphenyl)sulfanyl-2-oxo-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate |
| SMILES | COC(=O)[C@@]1(Sc2ccc(C)cc2)C[C@@H]2OC(=O)N(C(C)=O)[C@H]2[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C26H31NO12S/c1-13-7-9-18(10-8-13)40-26(24(32)34-6)11-19-21(27(14(2)28)25(33)38-19)23(39-26)22(37-17(5)31)20(36-16(4)30)12-35-15(3)29/h7-10,19-23H,11-12H2,1-6H3/t19-,20+,21+,22+,23+,26-/m0/s1 |
| InChIKey | YRDIRCKRRXTWGF-RNCZJOPTSA-N |
| XLogP | 1.91 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.60 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|