About 9-methoxyindeno[1,2-c]quinolin-11-one
9-methoxyindeno[1,2-c]quinolin-11-one (PubChem CID 44604383) has the molecular formula C17H11NO2
and a molecular weight of 261.28 g/mol. Its IUPAC name is 9-methoxyindeno[1,2-c]quinolin-11-one.
Molecular Properties
| Compound Name | 9-methoxyindeno[1,2-c]quinolin-11-one |
| PubChem CID | 44604383 |
| Molecular Formula | C17H11NO2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 9-methoxyindeno[1,2-c]quinolin-11-one |
| SMILES | COc1ccc2c(c1)C(=O)c1c-2cnc2ccccc12 |
| InChI | InChI=1S/C17H11NO2/c1-20-10-6-7-11-13(8-10)17(19)16-12-4-2-3-5-15(12)18-9-14(11)16/h2-9H,1H3 |
| InChIKey | WFPHUOKCFAUCHQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-methoxyindeno[1,2-c]quinolin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxyindeno[1,2-c]quinolin-11-one?
The IUPAC name of 9-methoxyindeno[1,2-c]quinolin-11-one (CID 44604383) is 9-methoxyindeno[1,2-c]quinolin-11-one.
What is the SMILES notation for 9-methoxyindeno[1,2-c]quinolin-11-one?
The canonical SMILES for 9-methoxyindeno[1,2-c]quinolin-11-one is COc1ccc2c(c1)C(=O)c1c-2cnc2ccccc12.
What is the InChIKey of 9-methoxyindeno[1,2-c]quinolin-11-one?
The InChIKey is WFPHUOKCFAUCHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO2/c1-20-10-6-7-11-13(8-10)17(19)16-12-4-2-3-5-15(12)18-9-14(11)16/h2-9H,1H3.
What are the key properties of 9-methoxyindeno[1,2-c]quinolin-11-one?
9-methoxyindeno[1,2-c]quinolin-11-one has a molecular weight of 261.28 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxyindeno[1,2-c]quinolin-11-one is sourced from PubChem (CID 44604383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).