About [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate
[(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate (PubChem CID 44604396) has the molecular formula C25H42O3Si
and a molecular weight of 418.69 g/mol. Its IUPAC name is [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate.
Molecular Properties
| Compound Name | [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate |
| PubChem CID | 44604396 |
| Molecular Formula | C25H42O3Si |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate |
| SMILES | C=C[C@@H](C[C@@H](CCCCCCC)O[Si](C)(C)C(C)(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H42O3Si/c1-8-10-11-12-16-19-23(28-29(6,7)25(3,4)5)20-22(9-2)27-24(26)21-17-14-13-15-18-21/h9,13-15,17-18,22-23H,2,8,10-12,16,19-20H2,1,3-7H3/t22-,23+/m0/s1 |
| InChIKey | AQGXFQOLOQQWRW-XZOQPEGZSA-N |
| XLogP | 7.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate?
The IUPAC name of [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate (CID 44604396) is [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate.
What is the SMILES notation for [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate?
The canonical SMILES for [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate is C=C[C@@H](C[C@@H](CCCCCCC)O[Si](C)(C)C(C)(C)C)OC(=O)c1ccccc1.
What is the InChIKey of [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate?
The InChIKey is AQGXFQOLOQQWRW-XZOQPEGZSA-N. The full InChI is InChI=1S/C25H42O3Si/c1-8-10-11-12-16-19-23(28-29(6,7)25(3,4)5)20-22(9-2)27-24(26)21-17-14-13-15-18-21/h9,13-15,17-18,22-23H,2,8,10-12,16,19-20H2,1,3-7H3/t22-,23+/m0/s1.
What are the key properties of [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate?
[(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate has a molecular weight of 418.69 g/mol, XLogP of 7.54, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxydodec-1-en-3-yl] benzoate is sourced from PubChem (CID 44604396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).