About (Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione
(Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione (PubChem CID 44604450) has the molecular formula C13H22N2O3
and a molecular weight of 254.33 g/mol. Its IUPAC name is (Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione.
Molecular Properties
| Compound Name | (Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione |
| PubChem CID | 44604450 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | (Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione |
| SMILES | CN1CCN(C(=O)/C(O)=C/C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H22N2O3/c1-13(2,3)11(17)9-10(16)12(18)15-7-5-14(4)6-8-15/h9,16H,5-8H2,1-4H3/b10-9- |
| InChIKey | ZLGGUPWPRLJXNI-KTKRTIGZSA-N |
| XLogP | 0.82 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione?
The IUPAC name of (Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione (CID 44604450) is (Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione.
What is the SMILES notation for (Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione?
The canonical SMILES for (Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione is CN1CCN(C(=O)/C(O)=C/C(=O)C(C)(C)C)CC1.
What is the InChIKey of (Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione?
The InChIKey is ZLGGUPWPRLJXNI-KTKRTIGZSA-N. The full InChI is InChI=1S/C13H22N2O3/c1-13(2,3)11(17)9-10(16)12(18)15-7-5-14(4)6-8-15/h9,16H,5-8H2,1-4H3/b10-9-.
What are the key properties of (Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione?
(Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione has a molecular weight of 254.33 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-hydroxy-5,5-dimethyl-1-(4-methylpiperazin-1-yl)hex-2-ene-1,4-dione is sourced from PubChem (CID 44604450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).