C22H33NO5Si — CID 44604475
(4R)-3-[(E,2R,3S)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylhex-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 44604475) has the molecular formula C22H33NO5Si and a molecular weight of 419.59 g/mol. Its IUPAC name is (4R)-3-[(E,2R,3S)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylhex-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(E,2R,3S)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylhex-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 44604475 |
| Molecular Formula | C22H33NO5Si |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (4R)-3-[(E,2R,3S)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylhex-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](C(=O)N1C(=O)OC[C@H]1c1ccccc1)[C@@H](O)/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H33NO5Si/c1-16(19(24)13-10-14-28-29(5,6)22(2,3)4)20(25)23-18(15-27-21(23)26)17-11-8-7-9-12-17/h7-13,16,18-19,24H,14-15H2,1-6H3/b13-10+/t16-,18+,19+/m1/s1 |
| InChIKey | HTNRIVBKBFJQJX-DWMNMANXSA-N |
| XLogP | 4.28 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|