About 3-phenylpyrido[1,2-c]pyrimidine-1-thione
3-phenylpyrido[1,2-c]pyrimidine-1-thione (PubChem CID 44604680) has the molecular formula C14H10N2S
and a molecular weight of 238.32 g/mol. Its IUPAC name is 3-phenylpyrido[1,2-c]pyrimidine-1-thione.
Molecular Properties
| Compound Name | 3-phenylpyrido[1,2-c]pyrimidine-1-thione |
| PubChem CID | 44604680 |
| Molecular Formula | C14H10N2S |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 3-phenylpyrido[1,2-c]pyrimidine-1-thione |
| SMILES | S=c1nc(-c2ccccc2)cc2ccccn12 |
| InChI | InChI=1S/C14H10N2S/c17-14-15-13(11-6-2-1-3-7-11)10-12-8-4-5-9-16(12)14/h1-10H |
| InChIKey | KBQZTBBHHLEEJY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpyrido[1,2-c]pyrimidine-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpyrido[1,2-c]pyrimidine-1-thione?
The IUPAC name of 3-phenylpyrido[1,2-c]pyrimidine-1-thione (CID 44604680) is 3-phenylpyrido[1,2-c]pyrimidine-1-thione.
What is the SMILES notation for 3-phenylpyrido[1,2-c]pyrimidine-1-thione?
The canonical SMILES for 3-phenylpyrido[1,2-c]pyrimidine-1-thione is S=c1nc(-c2ccccc2)cc2ccccn12.
What is the InChIKey of 3-phenylpyrido[1,2-c]pyrimidine-1-thione?
The InChIKey is KBQZTBBHHLEEJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2S/c17-14-15-13(11-6-2-1-3-7-11)10-12-8-4-5-9-16(12)14/h1-10H.
What are the key properties of 3-phenylpyrido[1,2-c]pyrimidine-1-thione?
3-phenylpyrido[1,2-c]pyrimidine-1-thione has a molecular weight of 238.32 g/mol, XLogP of 3.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpyrido[1,2-c]pyrimidine-1-thione is sourced from PubChem (CID 44604680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).