C25H38N2O — CID 44604735
(6Z,9Z)-20-(5-formyl-1H-pyrrol-2-yl)icosa-6,9-dienenitrile (PubChem CID 44604735) has the molecular formula C25H38N2O and a molecular weight of 382.59 g/mol. Its IUPAC name is (6Z,9Z)-20-(5-formyl-1H-pyrrol-2-yl)icosa-6,9-dienenitrile.
| Compound Name | (6Z,9Z)-20-(5-formyl-1H-pyrrol-2-yl)icosa-6,9-dienenitrile |
|---|---|
| PubChem CID | 44604735 |
| Molecular Formula | C25H38N2O |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.30 |
| IUPAC Name | (6Z,9Z)-20-(5-formyl-1H-pyrrol-2-yl)icosa-6,9-dienenitrile |
| SMILES | N#CCCCC/C=C\C/C=C\CCCCCCCCCCc1ccc(C=O)[nH]1 |
| InChI | InChI=1S/C25H38N2O/c26-22-18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19-24-20-21-25(23-28)27-24/h2,4,8,10,20-21,23,27H,1,3,5-7,9,11-19H2/b4-2-,10-8- |
| InChIKey | ZAQUCOXNPKIVGV-VBFFHFTGSA-N |
| XLogP | 7.47 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|