C21H28O3 — CID 44606076
(3R,5S)-3-[(7E)-hexadeca-7,15-dien-9,11-diynyl]-5-(hydroxymethyl)oxolan-2-one (PubChem CID 44606076) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (3R,5S)-3-[(7E)-hexadeca-7,15-dien-9,11-diynyl]-5-(hydroxymethyl)oxolan-2-one.
| Compound Name | (3R,5S)-3-[(7E)-hexadeca-7,15-dien-9,11-diynyl]-5-(hydroxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 44606076 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (3R,5S)-3-[(7E)-hexadeca-7,15-dien-9,11-diynyl]-5-(hydroxymethyl)oxolan-2-one |
| SMILES | C=CCCC#CC#C/C=C/CCCCCC[C@@H]1C[C@@H](CO)OC1=O |
| InChI | InChI=1S/C21H28O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-17-20(18-22)24-21(19)23/h2,9-10,19-20,22H,1,3-4,11-18H2/b10-9+/t19-,20+/m1/s1 |
| InChIKey | VKRYMBMEZLTVEX-FBWYZNFGSA-N |
| XLogP | 3.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|