C10H18O3 — CID 44606204
(2S,6R)-5,6-diethoxy-2-methyl-3,6-dihydro-2H-pyran (PubChem CID 44606204) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2S,6R)-5,6-diethoxy-2-methyl-3,6-dihydro-2H-pyran.
| Compound Name | (2S,6R)-5,6-diethoxy-2-methyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 44606204 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (2S,6R)-5,6-diethoxy-2-methyl-3,6-dihydro-2H-pyran |
| SMILES | CCOC1=CC[C@H](C)O[C@H]1OCC |
| InChI | InChI=1S/C10H18O3/c1-4-11-9-7-6-8(3)13-10(9)12-5-2/h7-8,10H,4-6H2,1-3H3/t8-,10+/m0/s1 |
| InChIKey | GGKHCLOHSCUXTE-WCBMZHEXSA-N |
| XLogP | 2.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |