C17H31ClSi2 — CID 44606246
(3-chloro-5-triethylsilylpenta-1,4-diynyl)-triethylsilane (PubChem CID 44606246) has the molecular formula C17H31ClSi2 and a molecular weight of 327.06 g/mol. Its IUPAC name is (3-chloro-5-triethylsilylpenta-1,4-diynyl)-triethylsilane.
| Compound Name | (3-chloro-5-triethylsilylpenta-1,4-diynyl)-triethylsilane |
|---|---|
| PubChem CID | 44606246 |
| Molecular Formula | C17H31ClSi2 |
| Molecular Weight | 327.06 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (3-chloro-5-triethylsilylpenta-1,4-diynyl)-triethylsilane |
| SMILES | CC[Si](C#CC(Cl)C#C[Si](CC)(CC)CC)(CC)CC |
| InChI | InChI=1S/C17H31ClSi2/c1-7-19(8-2,9-3)15-13-17(18)14-16-20(10-4,11-5)12-6/h17H,7-12H2,1-6H3 |
| InChIKey | HCERDTWEHTVXJV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.06 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|