C27H47N3O8 — CID 44606259
[(3aS,4R,6R,7R,7aS)-6-(8-azidooctoxy)-7-(2,2-dimethylpropanoyloxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl 2,2-dimethylpropanoate (PubChem CID 44606259) has the molecular formula C27H47N3O8 and a molecular weight of 541.69 g/mol. Its IUPAC name is [(3aS,4R,6R,7R,7aS)-6-(8-azidooctoxy)-7-(2,2-dimethylpropanoyloxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(3aS,4R,6R,7R,7aS)-6-(8-azidooctoxy)-7-(2,2-dimethylpropanoyloxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 44606259 |
| Molecular Formula | C27H47N3O8 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.34 |
| IUPAC Name | [(3aS,4R,6R,7R,7aS)-6-(8-azidooctoxy)-7-(2,2-dimethylpropanoyloxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](COC(=O)C(C)(C)C)O[C@@H](OCCCCCCCCN=[N+]=[N-])[C@@H]2OC(=O)C(C)(C)C |
| InChI | InChI=1S/C27H47N3O8/c1-25(2,3)23(31)34-17-18-19-20(38-27(7,8)37-19)21(36-24(32)26(4,5)6)22(35-18)33-16-14-12-10-9-11-13-15-29-30-28/h18-22H,9-17H2,1-8H3/t18-,19+,20+,21-,22-/m1/s1 |
| InChIKey | RKRKDWWBQXCFGY-CDJZJNNCSA-N |
| XLogP | 5.45 |
| TPSA | 138.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|