About (4S)-3,3-difluoro-4-phenylmethoxythiolane
(4S)-3,3-difluoro-4-phenylmethoxythiolane (PubChem CID 44606330) has the molecular formula C11H12F2OS
and a molecular weight of 230.28 g/mol. Its IUPAC name is (4S)-3,3-difluoro-4-phenylmethoxythiolane.
Molecular Properties
| Compound Name | (4S)-3,3-difluoro-4-phenylmethoxythiolane |
| PubChem CID | 44606330 |
| Molecular Formula | C11H12F2OS |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | (4S)-3,3-difluoro-4-phenylmethoxythiolane |
| SMILES | FC1(F)CSC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C11H12F2OS/c12-11(13)8-15-7-10(11)14-6-9-4-2-1-3-5-9/h1-5,10H,6-8H2/t10-/m1/s1 |
| InChIKey | OFATVRUIUMAHDB-SNVBAGLBSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-3,3-difluoro-4-phenylmethoxythiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3,3-difluoro-4-phenylmethoxythiolane?
The IUPAC name of (4S)-3,3-difluoro-4-phenylmethoxythiolane (CID 44606330) is (4S)-3,3-difluoro-4-phenylmethoxythiolane.
What is the SMILES notation for (4S)-3,3-difluoro-4-phenylmethoxythiolane?
The canonical SMILES for (4S)-3,3-difluoro-4-phenylmethoxythiolane is FC1(F)CSC[C@H]1OCc1ccccc1.
What is the InChIKey of (4S)-3,3-difluoro-4-phenylmethoxythiolane?
The InChIKey is OFATVRUIUMAHDB-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H12F2OS/c12-11(13)8-15-7-10(11)14-6-9-4-2-1-3-5-9/h1-5,10H,6-8H2/t10-/m1/s1.
What are the key properties of (4S)-3,3-difluoro-4-phenylmethoxythiolane?
(4S)-3,3-difluoro-4-phenylmethoxythiolane has a molecular weight of 230.28 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3,3-difluoro-4-phenylmethoxythiolane is sourced from PubChem (CID 44606330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).