C16H21N — CID 44606949
1-methyl-3,4-dipropylisoquinoline (PubChem CID 44606949) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-methyl-3,4-dipropylisoquinoline.
| Compound Name | 1-methyl-3,4-dipropylisoquinoline |
|---|---|
| PubChem CID | 44606949 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 1-methyl-3,4-dipropylisoquinoline |
| SMILES | CCCc1nc(C)c2ccccc2c1CCC |
| InChI | InChI=1S/C16H21N/c1-4-8-15-14-11-7-6-10-13(14)12(3)17-16(15)9-5-2/h6-7,10-11H,4-5,8-9H2,1-3H3 |
| InChIKey | ZTBGBGHZORDSHE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |