C22H24N2O6P2 — CID 44607044
N-[diethoxyphosphoryl(pyridin-4-yl)methyl]-6-oxobenzo[d][1,3,2]benzodioxaphosphepin-6-amine (PubChem CID 44607044) has the molecular formula C22H24N2O6P2 and a molecular weight of 474.39 g/mol. Its IUPAC name is N-[diethoxyphosphoryl(pyridin-4-yl)methyl]-6-oxobenzo[d][1,3,2]benzodioxaphosphepin-6-amine.
| Compound Name | N-[diethoxyphosphoryl(pyridin-4-yl)methyl]-6-oxobenzo[d][1,3,2]benzodioxaphosphepin-6-amine |
|---|---|
| PubChem CID | 44607044 |
| Molecular Formula | C22H24N2O6P2 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | N-[diethoxyphosphoryl(pyridin-4-yl)methyl]-6-oxobenzo[d][1,3,2]benzodioxaphosphepin-6-amine |
| SMILES | CCOP(=O)(OCC)C(NP1(=O)Oc2ccccc2-c2ccccc2O1)c1ccncc1 |
| InChI | InChI=1S/C22H24N2O6P2/c1-3-27-31(25,28-4-2)22(17-13-15-23-16-14-17)24-32(26)29-20-11-7-5-9-18(20)19-10-6-8-12-21(19)30-32/h5-16,22H,3-4H2,1-2H3,(H,24,26) |
| InChIKey | MAPDAAFUZWMELE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|