C17H10N2OS — CID 44607090
2-(1-benzofuran-2-yl)imidazo[2,1-b][1,3]benzothiazole (PubChem CID 44607090) has the molecular formula C17H10N2OS and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)imidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 2-(1-benzofuran-2-yl)imidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 44607090 |
| Molecular Formula | C17H10N2OS |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-(1-benzofuran-2-yl)imidazo[2,1-b][1,3]benzothiazole |
| SMILES | c1ccc2oc(-c3cn4c(n3)sc3ccccc34)cc2c1 |
| InChI | InChI=1S/C17H10N2OS/c1-3-7-14-11(5-1)9-15(20-14)12-10-19-13-6-2-4-8-16(13)21-17(19)18-12/h1-10H |
| InChIKey | WNYADNPQOKCZAF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |