C17H30O9S — CID 44607426
[(2S)-2-[(2R,3R,4S,5S,6S)-6-(acetylsulfanylmethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3-hydroxypropyl] hexanoate (PubChem CID 44607426) has the molecular formula C17H30O9S and a molecular weight of 410.49 g/mol. Its IUPAC name is [(2S)-2-[(2R,3R,4S,5S,6S)-6-(acetylsulfanylmethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3-hydroxypropyl] hexanoate.
| Compound Name | [(2S)-2-[(2R,3R,4S,5S,6S)-6-(acetylsulfanylmethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3-hydroxypropyl] hexanoate |
|---|---|
| PubChem CID | 44607426 |
| Molecular Formula | C17H30O9S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [(2S)-2-[(2R,3R,4S,5S,6S)-6-(acetylsulfanylmethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3-hydroxypropyl] hexanoate |
| SMILES | CCCCCC(=O)OC[C@H](CO)O[C@@H]1O[C@H](CSC(C)=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H30O9S/c1-3-4-5-6-13(20)24-8-11(7-18)25-17-16(23)15(22)14(21)12(26-17)9-27-10(2)19/h11-12,14-18,21-23H,3-9H2,1-2H3/t11-,12+,14+,15-,16+,17+/m0/s1 |
| InChIKey | NCZWSMASOLZBCR-HJIDVSFMSA-N |
| XLogP | -0.43 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|