C10H11NO — CID 44608024
(1R,2S,4R,5S,6R,8S)-3-oxatetracyclo[3.3.2.02,4.06,8]decane-7-carbonitrile (PubChem CID 44608024) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is (1R,2S,4R,5S,6R,8S)-3-oxatetracyclo[3.3.2.02,4.06,8]decane-7-carbonitrile.
| Compound Name | (1R,2S,4R,5S,6R,8S)-3-oxatetracyclo[3.3.2.02,4.06,8]decane-7-carbonitrile |
|---|---|
| PubChem CID | 44608024 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | (1R,2S,4R,5S,6R,8S)-3-oxatetracyclo[3.3.2.02,4.06,8]decane-7-carbonitrile |
| SMILES | N#CC1[C@@H]2[C@@H]3CC[C@@H]([C@@H]4O[C@H]34)[C@H]12 |
| InChI | InChI=1S/C10H11NO/c11-3-6-7-4-1-2-5(8(6)7)10-9(4)12-10/h4-10H,1-2H2/t4-,5+,6?,7-,8+,9+,10- |
| InChIKey | HALUYKRDDTZQTH-MPFXXULOSA-N |
| XLogP | 1.18 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|