C20H13F13O4S — CID 44608459
2-phenoxyethyl 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzenesulfonate (PubChem CID 44608459) has the molecular formula C20H13F13O4S and a molecular weight of 596.36 g/mol. Its IUPAC name is 2-phenoxyethyl 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzenesulfonate.
| Compound Name | 2-phenoxyethyl 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzenesulfonate |
|---|---|
| PubChem CID | 44608459 |
| Molecular Formula | C20H13F13O4S |
| Molecular Weight | 596.36 g/mol |
| Exact Mass | 596.03 |
| IUPAC Name | 2-phenoxyethyl 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzenesulfonate |
| SMILES | O=S(=O)(OCCOc1ccccc1)c1cccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C20H13F13O4S/c21-15(22,16(23,24)17(25,26)18(27,28)19(29,30)20(31,32)33)12-5-4-8-14(11-12)38(34,35)37-10-9-36-13-6-2-1-3-7-13/h1-8,11H,9-10H2 |
| InChIKey | YIWQRLPZYLNDIU-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.36 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|