C28H17F17O4S — CID 44608620
2-phenoxyethyl 4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]benzenesulfonate (PubChem CID 44608620) has the molecular formula C28H17F17O4S and a molecular weight of 772.47 g/mol. Its IUPAC name is 2-phenoxyethyl 4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]benzenesulfonate.
| Compound Name | 2-phenoxyethyl 4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]benzenesulfonate |
|---|---|
| PubChem CID | 44608620 |
| Molecular Formula | C28H17F17O4S |
| Molecular Weight | 772.47 g/mol |
| Exact Mass | 772.06 |
| IUPAC Name | 2-phenoxyethyl 4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]benzenesulfonate |
| SMILES | O=S(=O)(OCCOc1ccccc1)c1ccc(-c2ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H17F17O4S/c29-21(30,22(31,32)23(33,34)24(35,36)25(37,38)26(39,40)27(41,42)28(43,44)45)18-10-6-16(7-11-18)17-8-12-20(13-9-17)50(46,47)49-15-14-48-19-4-2-1-3-5-19/h1-13H,14-15H2 |
| InChIKey | SZESJNWZBYLBSJ-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.47 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|