C29H32Cl2N4O3S — CID 44608666
(2S,4S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 44608666) has the molecular formula C29H32Cl2N4O3S and a molecular weight of 587.57 g/mol. Its IUPAC name is (2S,4S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 44608666 |
| Molecular Formula | C29H32Cl2N4O3S |
| Molecular Weight | 587.57 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | (2S,4S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CC(C)C1=C(C(=O)N2C[C@@H](O)C[C@H]2C(=O)N(C)C)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C29H32Cl2N4O3S/c1-16(2)23-24(27(38)34-15-21(36)14-22(34)26(37)33(4)5)39-28-32-29(3,18-8-12-20(31)13-9-18)25(35(23)28)17-6-10-19(30)11-7-17/h6-13,16,21-22,25,36H,14-15H2,1-5H3/t21-,22-,25+,29-/m0/s1 |
| InChIKey | BPPGEPCJZCJAAG-PJZGNELNSA-N |
| XLogP | 5.29 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |