C14H12Br2N2O7S — CID 44608872
(3,5-dibromo-4-hydroxyphenyl)-(2,3-dihydropyrido[4,3-b][1,4]oxazin-4-yl)methanone;sulfuric acid (PubChem CID 44608872) has the molecular formula C14H12Br2N2O7S and a molecular weight of 512.13 g/mol. Its IUPAC name is (3,5-dibromo-4-hydroxyphenyl)-(2,3-dihydropyrido[4,3-b][1,4]oxazin-4-yl)methanone;sulfuric acid.
| Compound Name | (3,5-dibromo-4-hydroxyphenyl)-(2,3-dihydropyrido[4,3-b][1,4]oxazin-4-yl)methanone;sulfuric acid |
|---|---|
| PubChem CID | 44608872 |
| Molecular Formula | C14H12Br2N2O7S |
| Molecular Weight | 512.13 g/mol |
| Exact Mass | 509.87 |
| IUPAC Name | (3,5-dibromo-4-hydroxyphenyl)-(2,3-dihydropyrido[4,3-b][1,4]oxazin-4-yl)methanone;sulfuric acid |
| SMILES | O=C(c1cc(Br)c(O)c(Br)c1)N1CCOc2ccncc21.O=S(=O)(O)O |
| InChI | InChI=1S/C14H10Br2N2O3.H2O4S/c15-9-5-8(6-10(16)13(9)19)14(20)18-3-4-21-12-1-2-17-7-11(12)18;1-5(2,3)4/h1-2,5-7,19H,3-4H2;(H2,1,2,3,4) |
| InChIKey | VGCHTCDDUSPXPR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.13 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|