C15H17N5O4S — CID 44608951
(2S,3R,4R,5R)-2-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (PubChem CID 44608951) has the molecular formula C15H17N5O4S and a molecular weight of 363.40 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol.
| Compound Name | (2S,3R,4R,5R)-2-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 44608951 |
| Molecular Formula | C15H17N5O4S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (2S,3R,4R,5R)-2-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1c1cc(-c2nccs2)c2c(N)ncnn12 |
| InChI | InChI=1S/C15H17N5O4S/c1-15(23)11(22)9(5-21)24-12(15)8-4-7(14-17-2-3-25-14)10-13(16)18-6-19-20(8)10/h2-4,6,9,11-12,21-23H,5H2,1H3,(H2,16,18,19)/t9-,11-,12+,15-/m1/s1 |
| InChIKey | JMMKKBSWIKCROE-ADGXKJENSA-N |
| XLogP | -0.02 |
| TPSA | 139.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |