C12H15FN4O4 — CID 44608953
(2S,3R,4R,5R)-2-(4-amino-6-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (PubChem CID 44608953) has the molecular formula C12H15FN4O4 and a molecular weight of 298.27 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-(4-amino-6-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol.
| Compound Name | (2S,3R,4R,5R)-2-(4-amino-6-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 44608953 |
| Molecular Formula | C12H15FN4O4 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (2S,3R,4R,5R)-2-(4-amino-6-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1c1c(F)cc2c(N)ncnn12 |
| InChI | InChI=1S/C12H15FN4O4/c1-12(20)9(19)7(3-18)21-10(12)8-5(13)2-6-11(14)15-4-16-17(6)8/h2,4,7,9-10,18-20H,3H2,1H3,(H2,14,15,16)/t7-,9-,10+,12-/m1/s1 |
| InChIKey | NQTWYSXDLMFKMO-ZIYJGFGOSA-N |
| XLogP | -1.01 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |