C15H16BrN3O2S — CID 44609165
(5Z)-5-[[2-[(3R)-3-aminopiperidin-1-yl]-3-bromophenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 44609165) has the molecular formula C15H16BrN3O2S and a molecular weight of 382.28 g/mol. Its IUPAC name is (5Z)-5-[[2-[(3R)-3-aminopiperidin-1-yl]-3-bromophenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[(3R)-3-aminopiperidin-1-yl]-3-bromophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 44609165 |
| Molecular Formula | C15H16BrN3O2S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | (5Z)-5-[[2-[(3R)-3-aminopiperidin-1-yl]-3-bromophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | N[C@@H]1CCCN(c2c(Br)cccc2/C=C2\SC(=O)NC2=O)C1 |
| InChI | InChI=1S/C15H16BrN3O2S/c16-11-5-1-3-9(7-12-14(20)18-15(21)22-12)13(11)19-6-2-4-10(17)8-19/h1,3,5,7,10H,2,4,6,8,17H2,(H,18,20,21)/b12-7-/t10-/m1/s1 |
| InChIKey | PYWZTKODXYPZLR-VPMLRQHESA-N |
| XLogP | 2.70 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|