C22H30FN3O4 — CID 44609437
2-[2-fluoro-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]phenyl]propanoic acid (PubChem CID 44609437) has the molecular formula C22H30FN3O4 and a molecular weight of 419.50 g/mol. Its IUPAC name is 2-[2-fluoro-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]phenyl]propanoic acid.
| Compound Name | 2-[2-fluoro-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 44609437 |
| Molecular Formula | C22H30FN3O4 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-[2-fluoro-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]phenyl]propanoic acid |
| SMILES | CC(C)c1noc(N2CCC(CCCOc3ccc(C(C)C(=O)O)c(F)c3)CC2)n1 |
| InChI | InChI=1S/C22H30FN3O4/c1-14(2)20-24-22(30-25-20)26-10-8-16(9-11-26)5-4-12-29-17-6-7-18(19(23)13-17)15(3)21(27)28/h6-7,13-16H,4-5,8-12H2,1-3H3,(H,27,28) |
| InChIKey | FCEKYSVAXRRFIZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|