C33H37N7 — CID 44609708
3-N-(2-cyclopentyl-3,4-dihydro-1H-isoquinolin-7-yl)-1-(6-phenyl-3-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-4-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 44609708) has the molecular formula C33H37N7 and a molecular weight of 531.71 g/mol. Its IUPAC name is 3-N-(2-cyclopentyl-3,4-dihydro-1H-isoquinolin-7-yl)-1-(6-phenyl-3-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-4-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(2-cyclopentyl-3,4-dihydro-1H-isoquinolin-7-yl)-1-(6-phenyl-3-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-4-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 44609708 |
| Molecular Formula | C33H37N7 |
| Molecular Weight | 531.71 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | 3-N-(2-cyclopentyl-3,4-dihydro-1H-isoquinolin-7-yl)-1-(6-phenyl-3-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-4-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2ccc3c(c2)CN(C2CCCC2)CC3)nn1-c1cc(-c2ccccc2)c2c(n1)C1CCC2CC1 |
| InChI | InChI=1S/C33H37N7/c34-32-37-33(35-26-15-14-21-16-17-39(20-25(21)18-26)27-8-4-5-9-27)38-40(32)29-19-28(22-6-2-1-3-7-22)30-23-10-12-24(13-11-23)31(30)36-29/h1-3,6-7,14-15,18-19,23-24,27H,4-5,8-13,16-17,20H2,(H3,34,35,37,38) |
| InChIKey | AKTUPTWDCNBBIK-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.71 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |