About N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide
N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 44610008) has the molecular formula C19H12ClFN4O2S
and a molecular weight of 414.85 g/mol. Its IUPAC name is N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide |
| PubChem CID | 44610008 |
| Molecular Formula | C19H12ClFN4O2S |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2cnc3ncccc3c2)cnc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H12ClFN4O2S/c20-18-17(25-28(26,27)16-5-3-15(21)4-6-16)9-14(10-23-18)13-8-12-2-1-7-22-19(12)24-11-13/h1-11,25H |
| InChIKey | GVTHYMBGAHNEQM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide?
The IUPAC name of N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide (CID 44610008) is N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide.
What is the SMILES notation for N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide?
The canonical SMILES for N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide is O=S(=O)(Nc1cc(-c2cnc3ncccc3c2)cnc1Cl)c1ccc(F)cc1.
What is the InChIKey of N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide?
The InChIKey is GVTHYMBGAHNEQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12ClFN4O2S/c20-18-17(25-28(26,27)16-5-3-15(21)4-6-16)9-14(10-23-18)13-8-12-2-1-7-22-19(12)24-11-13/h1-11,25H.
What are the key properties of N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide?
N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide has a molecular weight of 414.85 g/mol, XLogP of 4.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-chloro-5-(1,8-naphthyridin-3-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide is sourced from PubChem (CID 44610008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).