C21H19ClN4O3S — CID 44610100
N-[(3S)-1-[2-chloro-6-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]pyrrolidin-3-yl]-2-pyridin-4-ylacetamide (PubChem CID 44610100) has the molecular formula C21H19ClN4O3S and a molecular weight of 442.93 g/mol. Its IUPAC name is N-[(3S)-1-[2-chloro-6-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]pyrrolidin-3-yl]-2-pyridin-4-ylacetamide.
| Compound Name | N-[(3S)-1-[2-chloro-6-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]pyrrolidin-3-yl]-2-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 44610100 |
| Molecular Formula | C21H19ClN4O3S |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N-[(3S)-1-[2-chloro-6-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]pyrrolidin-3-yl]-2-pyridin-4-ylacetamide |
| SMILES | O=C(Cc1ccncc1)N[C@H]1CCN(c2c(Cl)cccc2/C=C2\SC(=O)NC2=O)C1 |
| InChI | InChI=1S/C21H19ClN4O3S/c22-16-3-1-2-14(11-17-20(28)25-21(29)30-17)19(16)26-9-6-15(12-26)24-18(27)10-13-4-7-23-8-5-13/h1-5,7-8,11,15H,6,9-10,12H2,(H,24,27)(H,25,28,29)/b17-11-/t15-/m0/s1 |
| InChIKey | DGFOYAGXKGPDEC-ZCQLHAAUSA-N |
| XLogP | 3.00 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|