C23H21BrO5S — CID 44610199
2-[3-[4-bromo-2-(2-phenylethylsulfonylmethyl)phenoxy]phenyl]acetic acid (PubChem CID 44610199) has the molecular formula C23H21BrO5S and a molecular weight of 489.39 g/mol. Its IUPAC name is 2-[3-[4-bromo-2-(2-phenylethylsulfonylmethyl)phenoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[4-bromo-2-(2-phenylethylsulfonylmethyl)phenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 44610199 |
| Molecular Formula | C23H21BrO5S |
| Molecular Weight | 489.39 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 2-[3-[4-bromo-2-(2-phenylethylsulfonylmethyl)phenoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(Oc2ccc(Br)cc2CS(=O)(=O)CCc2ccccc2)c1 |
| InChI | InChI=1S/C23H21BrO5S/c24-20-9-10-22(29-21-8-4-7-18(13-21)14-23(25)26)19(15-20)16-30(27,28)12-11-17-5-2-1-3-6-17/h1-10,13,15H,11-12,14,16H2,(H,25,26) |
| InChIKey | KIZCXKBANORNQY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |