C21H20N4O2 — CID 44610746
3-[(Z)-(5-benzyl-1,4,5-trimethyl-3,6-dioxopiperazin-2-ylidene)methyl]pyridine-2-carbonitrile (PubChem CID 44610746) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 3-[(Z)-(5-benzyl-1,4,5-trimethyl-3,6-dioxopiperazin-2-ylidene)methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[(Z)-(5-benzyl-1,4,5-trimethyl-3,6-dioxopiperazin-2-ylidene)methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 44610746 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 3-[(Z)-(5-benzyl-1,4,5-trimethyl-3,6-dioxopiperazin-2-ylidene)methyl]pyridine-2-carbonitrile |
| SMILES | CN1C(=O)C(C)(Cc2ccccc2)N(C)C(=O)/C1=C/c1cccnc1C#N |
| InChI | InChI=1S/C21H20N4O2/c1-21(13-15-8-5-4-6-9-15)20(27)24(2)18(19(26)25(21)3)12-16-10-7-11-23-17(16)14-22/h4-12H,13H2,1-3H3/b18-12- |
| InChIKey | QDFQXENEUQXWMS-PDGQHHTCSA-N |
| XLogP | 2.23 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|