About (1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate
(1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate (PubChem CID 44610761) has the molecular formula C20H17N3O3
and a molecular weight of 347.37 g/mol. Its IUPAC name is (1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate.
Molecular Properties
| Compound Name | (1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate |
| PubChem CID | 44610761 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate |
| SMILES | Cc1ccc2cc3c(OC(=O)COc4ccccc4)nn(C)c3nc2c1 |
| InChI | InChI=1S/C20H17N3O3/c1-13-8-9-14-11-16-19(21-17(14)10-13)23(2)22-20(16)26-18(24)12-25-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3 |
| InChIKey | PMSZFNMDLPXPCA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate?
The IUPAC name of (1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate (CID 44610761) is (1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate.
What is the SMILES notation for (1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate?
The canonical SMILES for (1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate is Cc1ccc2cc3c(OC(=O)COc4ccccc4)nn(C)c3nc2c1.
What is the InChIKey of (1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate?
The InChIKey is PMSZFNMDLPXPCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O3/c1-13-8-9-14-11-16-19(21-17(14)10-13)23(2)22-20(16)26-18(24)12-25-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3.
What are the key properties of (1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate?
(1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate has a molecular weight of 347.37 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1,7-dimethylpyrazolo[5,4-b]quinolin-3-yl) 2-phenoxyacetate is sourced from PubChem (CID 44610761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).