C25H20F2N8O3 — CID 44611146
1-[3-(2,4-difluorophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione (PubChem CID 44611146) has the molecular formula C25H20F2N8O3 and a molecular weight of 518.48 g/mol. Its IUPAC name is 1-[3-(2,4-difluorophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-[3-(2,4-difluorophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 44611146 |
| Molecular Formula | C25H20F2N8O3 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 1-[3-(2,4-difluorophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
| SMILES | COc1cnc(-n2cnc(C)n2)c2[nH]cc(C(=O)C(=O)N3CCn4c(cnc4-c4ccc(F)cc4F)C3)c12 |
| InChI | InChI=1S/C25H20F2N8O3/c1-13-31-12-35(32-13)24-21-20(19(38-2)10-30-24)17(9-28-21)22(36)25(37)33-5-6-34-15(11-33)8-29-23(34)16-4-3-14(26)7-18(16)27/h3-4,7-10,12,28H,5-6,11H2,1-2H3 |
| InChIKey | VUNSCKXXTGLJQN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|