C25H27F6N5O6 — CID 44611419
(2-carbamimidoyl-1,3-dihydroisoindol-5-yl)methyl 1-pyridin-4-ylpiperidine-4-carboxylate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 44611419) has the molecular formula C25H27F6N5O6 and a molecular weight of 607.51 g/mol. Its IUPAC name is (2-carbamimidoyl-1,3-dihydroisoindol-5-yl)methyl 1-pyridin-4-ylpiperidine-4-carboxylate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2-carbamimidoyl-1,3-dihydroisoindol-5-yl)methyl 1-pyridin-4-ylpiperidine-4-carboxylate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 44611419 |
| Molecular Formula | C25H27F6N5O6 |
| Molecular Weight | 607.51 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | (2-carbamimidoyl-1,3-dihydroisoindol-5-yl)methyl 1-pyridin-4-ylpiperidine-4-carboxylate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)N1Cc2ccc(COC(=O)C3CCN(c4ccncc4)CC3)cc2C1 |
| InChI | InChI=1S/C21H25N5O2.2C2HF3O2/c22-21(23)26-12-17-2-1-15(11-18(17)13-26)14-28-20(27)16-5-9-25(10-6-16)19-3-7-24-8-4-19;2*3-2(4,5)1(6)7/h1-4,7-8,11,16H,5-6,9-10,12-14H2,(H3,22,23);2*(H,6,7) |
| InChIKey | VKOCVBQDNKCJBN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 170.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|