About 3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one
3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one (PubChem CID 44612793) has the molecular formula C13H22N2OS
and a molecular weight of 254.40 g/mol. Its IUPAC name is 3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one |
| PubChem CID | 44612793 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)CSC1C1=CCCN(C)C1 |
| InChI | InChI=1S/C13H22N2OS/c1-3-4-8-15-12(16)10-17-13(15)11-6-5-7-14(2)9-11/h6,13H,3-5,7-10H2,1-2H3 |
| InChIKey | FAXDBBDSLCEOCJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one?
The IUPAC name of 3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one (CID 44612793) is 3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one?
The canonical SMILES for 3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one is CCCCN1C(=O)CSC1C1=CCCN(C)C1.
What is the InChIKey of 3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one?
The InChIKey is FAXDBBDSLCEOCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2OS/c1-3-4-8-15-12(16)10-17-13(15)11-6-5-7-14(2)9-11/h6,13H,3-5,7-10H2,1-2H3.
What are the key properties of 3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one?
3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one has a molecular weight of 254.40 g/mol, XLogP of 1.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 44612793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).