About 8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride
8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride (PubChem CID 44613059) has the molecular formula C17H18Cl2FN3
and a molecular weight of 354.26 g/mol. Its IUPAC name is 8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride.
Molecular Properties
| Compound Name | 8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride |
| PubChem CID | 44613059 |
| Molecular Formula | C17H18Cl2FN3 |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride |
| SMILES | CN1CCc2c(c3cc(F)ccc3n2-c2ccncc2)C1.Cl.Cl |
| InChI | InChI=1S/C17H16FN3.2ClH/c1-20-9-6-17-15(11-20)14-10-12(18)2-3-16(14)21(17)13-4-7-19-8-5-13;;/h2-5,7-8,10H,6,9,11H2,1H3;2*1H |
| InChIKey | NYXDFMCFQGVGDJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride?
The IUPAC name of 8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride (CID 44613059) is 8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride.
What is the SMILES notation for 8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride?
The canonical SMILES for 8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride is CN1CCc2c(c3cc(F)ccc3n2-c2ccncc2)C1.Cl.Cl.
What is the InChIKey of 8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride?
The InChIKey is NYXDFMCFQGVGDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FN3.2ClH/c1-20-9-6-17-15(11-20)14-10-12(18)2-3-16(14)21(17)13-4-7-19-8-5-13;;/h2-5,7-8,10H,6,9,11H2,1H3;2*1H.
What are the key properties of 8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride?
8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride has a molecular weight of 354.26 g/mol, XLogP of 4.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-2-methyl-5-pyridin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride is sourced from PubChem (CID 44613059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).