C18H20N4O3 — CID 44613135
(NZ)-N-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-pyridin-3-ylmethylidene]hydroxylamine (PubChem CID 44613135) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is (NZ)-N-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-pyridin-3-ylmethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-pyridin-3-ylmethylidene]hydroxylamine |
|---|---|
| PubChem CID | 44613135 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (NZ)-N-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-pyridin-3-ylmethylidene]hydroxylamine |
| SMILES | O/N=C(/c1cccnc1)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C18H20N4O3/c23-20-18(15-2-1-5-19-11-15)22-8-6-21(7-9-22)12-14-3-4-16-17(10-14)25-13-24-16/h1-5,10-11,23H,6-9,12-13H2/b20-18- |
| InChIKey | LTYAZPUTCSCCBV-ZZEZOPTASA-N |
| XLogP | 1.76 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|